C23H28N4O3S2 — CID 139687826
2-(1H-benzimidazol-2-ylsulfinyl)-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide (PubChem CID 139687826) has the molecular formula C23H28N4O3S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfinyl)-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfinyl)-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide |
|---|---|
| PubChem CID | 139687826 |
| Molecular Formula | C23H28N4O3S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfinyl)-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide |
| SMILES | O=C(CS(=O)c1nc2ccccc2[nH]1)N/C=C\CCOc1csc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C23H28N4O3S2/c28-22(17-32(29)23-25-20-8-2-3-9-21(20)26-23)24-10-4-7-13-30-18-14-19(31-16-18)15-27-11-5-1-6-12-27/h2-4,8-10,14,16H,1,5-7,11-13,15,17H2,(H,24,28)(H,25,26)/b10-4- |
| InChIKey | ZINNCWNXEKCCCD-WMZJFQQLSA-N |
| XLogP | 3.82 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|