C22H32N4O3S2 — CID 139686583
4-(furan-2-ylcarbamothioylamino)-N-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]butanamide (PubChem CID 139686583) has the molecular formula C22H32N4O3S2 and a molecular weight of 464.66 g/mol. Its IUPAC name is 4-(furan-2-ylcarbamothioylamino)-N-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]butanamide.
| Compound Name | 4-(furan-2-ylcarbamothioylamino)-N-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]butanamide |
|---|---|
| PubChem CID | 139686583 |
| Molecular Formula | C22H32N4O3S2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-(furan-2-ylcarbamothioylamino)-N-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]butanamide |
| SMILES | O=C(CCCNC(=S)Nc1ccco1)NCCCOc1csc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C22H32N4O3S2/c27-20(7-4-9-24-22(30)25-21-8-5-13-29-21)23-10-6-14-28-18-15-19(31-17-18)16-26-11-2-1-3-12-26/h5,8,13,15,17H,1-4,6-7,9-12,14,16H2,(H,23,27)(H2,24,25,30) |
| InChIKey | WYXVHVNBRCJEFK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|