C23H33N3OS2 — CID 139686614
1-(2-phenylethyl)-3-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybutyl]thiourea (PubChem CID 139686614) has the molecular formula C23H33N3OS2 and a molecular weight of 431.67 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybutyl]thiourea.
| Compound Name | 1-(2-phenylethyl)-3-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybutyl]thiourea |
|---|---|
| PubChem CID | 139686614 |
| Molecular Formula | C23H33N3OS2 |
| Molecular Weight | 431.67 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 1-(2-phenylethyl)-3-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybutyl]thiourea |
| SMILES | S=C(NCCCCOc1csc(CN2CCCCC2)c1)NCCc1ccccc1 |
| InChI | InChI=1S/C23H33N3OS2/c28-23(25-13-11-20-9-3-1-4-10-20)24-12-5-8-16-27-21-17-22(29-19-21)18-26-14-6-2-7-15-26/h1,3-4,9-10,17,19H,2,5-8,11-16,18H2,(H2,24,25,28) |
| InChIKey | PPCWOHOHDUZBEX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|