C23H30N4O2S2 — CID 139687902
2-(1H-benzimidazol-2-ylsulfanyl)-N-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybutyl]acetamide (PubChem CID 139687902) has the molecular formula C23H30N4O2S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybutyl]acetamide.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybutyl]acetamide |
|---|---|
| PubChem CID | 139687902 |
| Molecular Formula | C23H30N4O2S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybutyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2[nH]1)NCCCCOc1csc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C23H30N4O2S2/c28-22(17-31-23-25-20-8-2-3-9-21(20)26-23)24-10-4-7-13-29-18-14-19(30-16-18)15-27-11-5-1-6-12-27/h2-3,8-9,14,16H,1,4-7,10-13,15,17H2,(H,24,28)(H,25,26) |
| InChIKey | PWPUUDQSKUIVCA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|