C26H36N4O2S2 — CID 139686619
4-[(4-methylphenyl)carbamothioylamino]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]butanamide (PubChem CID 139686619) has the molecular formula C26H36N4O2S2 and a molecular weight of 500.73 g/mol. Its IUPAC name is 4-[(4-methylphenyl)carbamothioylamino]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]butanamide.
| Compound Name | 4-[(4-methylphenyl)carbamothioylamino]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]butanamide |
|---|---|
| PubChem CID | 139686619 |
| Molecular Formula | C26H36N4O2S2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 4-[(4-methylphenyl)carbamothioylamino]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]butanamide |
| SMILES | Cc1ccc(NC(=S)NCCCC(=O)N/C=C\CCOc2csc(CN3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C26H36N4O2S2/c1-21-9-11-22(12-10-21)29-26(33)28-14-7-8-25(31)27-13-3-6-17-32-23-18-24(34-20-23)19-30-15-4-2-5-16-30/h3,9-13,18,20H,2,4-8,14-17,19H2,1H3,(H,27,31)(H2,28,29,33)/b13-3- |
| InChIKey | SDMJZGVKBLXJET-DXNYSGJVSA-N |
| XLogP | 5.21 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|