C22H27FN2O2S2 — CID 139687903
2-[(3-fluorophenyl)methylsulfanyl]-N-[(Z)-4-[5-(pyrrolidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide (PubChem CID 139687903) has the molecular formula C22H27FN2O2S2 and a molecular weight of 434.60 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methylsulfanyl]-N-[(Z)-4-[5-(pyrrolidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide.
| Compound Name | 2-[(3-fluorophenyl)methylsulfanyl]-N-[(Z)-4-[5-(pyrrolidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide |
|---|---|
| PubChem CID | 139687903 |
| Molecular Formula | C22H27FN2O2S2 |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[(3-fluorophenyl)methylsulfanyl]-N-[(Z)-4-[5-(pyrrolidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide |
| SMILES | O=C(CSCc1cccc(F)c1)N/C=C\CCOc1csc(CN2CCCC2)c1 |
| InChI | InChI=1S/C22H27FN2O2S2/c23-19-7-5-6-18(12-19)15-28-17-22(26)24-8-1-4-11-27-20-13-21(29-16-20)14-25-9-2-3-10-25/h1,5-8,12-13,16H,2-4,9-11,14-15,17H2,(H,24,26)/b8-1- |
| InChIKey | CVUGRZUZTPFASD-QPIMQUGISA-N |
| XLogP | 4.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|