C23H29FN2O2S2 — CID 139687908
2-[(4-fluorophenyl)methylsulfanyl]-N-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-2-enyl]acetamide (PubChem CID 139687908) has the molecular formula C23H29FN2O2S2 and a molecular weight of 448.63 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-N-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-2-enyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-2-enyl]acetamide |
|---|---|
| PubChem CID | 139687908 |
| Molecular Formula | C23H29FN2O2S2 |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-N-[4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-2-enyl]acetamide |
| SMILES | O=C(CSCc1ccc(F)cc1)NCC=CCOc1csc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C23H29FN2O2S2/c24-20-8-6-19(7-9-20)16-29-18-23(27)25-10-2-5-13-28-21-14-22(30-17-21)15-26-11-3-1-4-12-26/h2,5-9,14,17H,1,3-4,10-13,15-16,18H2,(H,25,27) |
| InChIKey | KXAXHVSYRYLVJA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|