C25H32N4O6S — CID 67800811
5-nitro-N-[2-[2-oxo-2-[[(Z)-4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]ethyl]sulfanylethyl]furan-2-carboxamide (PubChem CID 67800811) has the molecular formula C25H32N4O6S and a molecular weight of 516.62 g/mol. Its IUPAC name is 5-nitro-N-[2-[2-oxo-2-[[(Z)-4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]ethyl]sulfanylethyl]furan-2-carboxamide.
| Compound Name | 5-nitro-N-[2-[2-oxo-2-[[(Z)-4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]ethyl]sulfanylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 67800811 |
| Molecular Formula | C25H32N4O6S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 5-nitro-N-[2-[2-oxo-2-[[(Z)-4-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]ethyl]sulfanylethyl]furan-2-carboxamide |
| SMILES | O=C(CSCCNC(=O)c1ccc([N+](=O)[O-])o1)NC/C=C\COc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C25H32N4O6S/c30-23(19-36-16-12-27-25(31)22-9-10-24(35-22)29(32)33)26-11-2-5-15-34-21-8-6-7-20(17-21)18-28-13-3-1-4-14-28/h2,5-10,17H,1,3-4,11-16,18-19H2,(H,26,30)(H,27,31)/b5-2- |
| InChIKey | VJKCMEBBLMFQLG-DJWKRKHSSA-N |
| XLogP | 3.39 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|