C25H33ClN4O2S2 — CID 139686572
4-[(4-chlorophenyl)carbamothioylamino]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]butanamide (PubChem CID 139686572) has the molecular formula C25H33ClN4O2S2 and a molecular weight of 521.15 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)carbamothioylamino]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]butanamide.
| Compound Name | 4-[(4-chlorophenyl)carbamothioylamino]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]butanamide |
|---|---|
| PubChem CID | 139686572 |
| Molecular Formula | C25H33ClN4O2S2 |
| Molecular Weight | 521.15 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 4-[(4-chlorophenyl)carbamothioylamino]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]butanamide |
| SMILES | O=C(CCCNC(=S)Nc1ccc(Cl)cc1)N/C=C\CCOc1csc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C25H33ClN4O2S2/c26-20-8-10-21(11-9-20)29-25(33)28-13-6-7-24(31)27-12-2-5-16-32-22-17-23(34-19-22)18-30-14-3-1-4-15-30/h2,8-12,17,19H,1,3-7,13-16,18H2,(H,27,31)(H2,28,29,33)/b12-2- |
| InChIKey | ASPZVDMUHHEQGR-OIXVIMQBSA-N |
| XLogP | 5.55 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.15 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|