C25H36N4O2S3 — CID 139686600
N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]-4-(2-thiophen-2-ylethylcarbamothioylamino)butanamide (PubChem CID 139686600) has the molecular formula C25H36N4O2S3 and a molecular weight of 520.79 g/mol. Its IUPAC name is N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]-4-(2-thiophen-2-ylethylcarbamothioylamino)butanamide.
| Compound Name | N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]-4-(2-thiophen-2-ylethylcarbamothioylamino)butanamide |
|---|---|
| PubChem CID | 139686600 |
| Molecular Formula | C25H36N4O2S3 |
| Molecular Weight | 520.79 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]-4-(2-thiophen-2-ylethylcarbamothioylamino)butanamide |
| SMILES | O=C(CCCNC(=S)NCCc1cccs1)N/C=C\CCOc1csc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C25H36N4O2S3/c30-24(9-6-12-27-25(32)28-13-10-22-8-7-17-33-22)26-11-2-5-16-31-21-18-23(34-20-21)19-29-14-3-1-4-15-29/h2,7-8,11,17-18,20H,1,3-6,9-10,12-16,19H2,(H,26,30)(H2,27,28,32)/b11-2- |
| InChIKey | CSXJQCMTEXNJAY-FUQNDXKWSA-N |
| XLogP | 4.68 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|