C26H38N4O4S2 — CID 139686612
4-[(3,4-dimethoxyphenyl)carbamothioylamino]-N-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]butanamide (PubChem CID 139686612) has the molecular formula C26H38N4O4S2 and a molecular weight of 534.75 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)carbamothioylamino]-N-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]butanamide.
| Compound Name | 4-[(3,4-dimethoxyphenyl)carbamothioylamino]-N-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]butanamide |
|---|---|
| PubChem CID | 139686612 |
| Molecular Formula | C26H38N4O4S2 |
| Molecular Weight | 534.75 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)carbamothioylamino]-N-[3-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxypropyl]butanamide |
| SMILES | COc1ccc(NC(=S)NCCCC(=O)NCCCOc2csc(CN3CCCCC3)c2)cc1OC |
| InChI | InChI=1S/C26H38N4O4S2/c1-32-23-10-9-20(16-24(23)33-2)29-26(35)28-11-6-8-25(31)27-12-7-15-34-21-17-22(36-19-21)18-30-13-4-3-5-14-30/h9-10,16-17,19H,3-8,11-15,18H2,1-2H3,(H,27,31)(H2,28,29,35) |
| InChIKey | IGWJBZUXMUOVDZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|