C21H32N4O3S2 — CID 139686641
N-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-4-[2-(furan-2-yl)ethylcarbamothioylamino]butanamide (PubChem CID 139686641) has the molecular formula C21H32N4O3S2 and a molecular weight of 452.65 g/mol. Its IUPAC name is N-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-4-[2-(furan-2-yl)ethylcarbamothioylamino]butanamide.
| Compound Name | N-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-4-[2-(furan-2-yl)ethylcarbamothioylamino]butanamide |
|---|---|
| PubChem CID | 139686641 |
| Molecular Formula | C21H32N4O3S2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-4-[2-(furan-2-yl)ethylcarbamothioylamino]butanamide |
| SMILES | CN(C)Cc1cc(OCCCNC(=O)CCCNC(=S)NCCc2ccco2)cs1 |
| InChI | InChI=1S/C21H32N4O3S2/c1-25(2)15-19-14-18(16-30-19)28-13-5-10-22-20(26)7-3-9-23-21(29)24-11-8-17-6-4-12-27-17/h4,6,12,14,16H,3,5,7-11,13,15H2,1-2H3,(H,22,26)(H2,23,24,29) |
| InChIKey | MCSFLYXUJZSWQD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|