C21H30N4O2S2 — CID 139686568
N-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-4-(phenylcarbamothioylamino)butanamide (PubChem CID 139686568) has the molecular formula C21H30N4O2S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is N-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-4-(phenylcarbamothioylamino)butanamide.
| Compound Name | N-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-4-(phenylcarbamothioylamino)butanamide |
|---|---|
| PubChem CID | 139686568 |
| Molecular Formula | C21H30N4O2S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[3-[5-[(dimethylamino)methyl]thiophen-3-yl]oxypropyl]-4-(phenylcarbamothioylamino)butanamide |
| SMILES | CN(C)Cc1cc(OCCCNC(=O)CCCNC(=S)Nc2ccccc2)cs1 |
| InChI | InChI=1S/C21H30N4O2S2/c1-25(2)15-19-14-18(16-29-19)27-13-7-12-22-20(26)10-6-11-23-21(28)24-17-8-4-3-5-9-17/h3-5,8-9,14,16H,6-7,10-13,15H2,1-2H3,(H,22,26)(H2,23,24,28) |
| InChIKey | HPELPWVPZPNDAU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|