C10H11N2NaO6 — CID 139688149
sodium (6R,7R)-7-[(1R)-1-hydroxyethyl]-3-(hydroxyiminomethyl)-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139688149) has the molecular formula C10H11N2NaO6 and a molecular weight of 278.20 g/mol. Its IUPAC name is sodium (6R,7R)-7-[(1R)-1-hydroxyethyl]-3-(hydroxyiminomethyl)-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6R,7R)-7-[(1R)-1-hydroxyethyl]-3-(hydroxyiminomethyl)-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139688149 |
| Molecular Formula | C10H11N2NaO6 |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | sodium (6R,7R)-7-[(1R)-1-hydroxyethyl]-3-(hydroxyiminomethyl)-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)[O-])=C(C=NO)CO[C@H]12.[Na+] |
| InChI | InChI=1S/C10H12N2O6.Na/c1-4(13)6-8(14)12-7(10(15)16)5(2-11-17)3-18-9(6)12;/h2,4,6,9,13,17H,3H2,1H3,(H,15,16);/q;+1/p-1/t4-,6+,9-;/m1./s1 |
| InChIKey | BNUBOZOOYAGEAI-ODYOSOFBSA-M |
| XLogP | -5.35 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|