C19H19BrFNO3S — CID 139689432
methyl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylpentanoate (PubChem CID 139689432) has the molecular formula C19H19BrFNO3S and a molecular weight of 440.33 g/mol. Its IUPAC name is methyl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylpentanoate.
| Compound Name | methyl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylpentanoate |
|---|---|
| PubChem CID | 139689432 |
| Molecular Formula | C19H19BrFNO3S |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | methyl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylpentanoate |
| SMILES | CCCC(Sc1cc(NC(=O)c2ccccc2)c(F)cc1Br)C(=O)OC |
| InChI | InChI=1S/C19H19BrFNO3S/c1-3-7-16(19(24)25-2)26-17-11-15(14(21)10-13(17)20)22-18(23)12-8-5-4-6-9-12/h4-6,8-11,16H,3,7H2,1-2H3,(H,22,23) |
| InChIKey | RTNQGYFFRWGADA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |