C25H25N3O2 — CID 139690669
N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2,3-dimethylbenzohydrazide (PubChem CID 139690669) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2,3-dimethylbenzohydrazide.
| Compound Name | N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2,3-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 139690669 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]-2,3-dimethylbenzohydrazide |
| SMILES | Cc1cccc(C(=O)N(N)c2ccc(C(=O)N3CCCc4ccccc43)cc2)c1C |
| InChI | InChI=1S/C25H25N3O2/c1-17-7-5-10-22(18(17)2)25(30)28(26)21-14-12-20(13-15-21)24(29)27-16-6-9-19-8-3-4-11-23(19)27/h3-5,7-8,10-15H,6,9,16,26H2,1-2H3 |
| InChIKey | WKQCIBRRFCMXFS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|