C16H17NO4 — CID 139691610
2-(1-hydroxy-5-methyl-4-oxohex-5-enyl)-5-methylisoindole-1,3-dione (PubChem CID 139691610) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-(1-hydroxy-5-methyl-4-oxohex-5-enyl)-5-methylisoindole-1,3-dione.
| Compound Name | 2-(1-hydroxy-5-methyl-4-oxohex-5-enyl)-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 139691610 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(1-hydroxy-5-methyl-4-oxohex-5-enyl)-5-methylisoindole-1,3-dione |
| SMILES | C=C(C)C(=O)CCC(O)N1C(=O)c2ccc(C)cc2C1=O |
| InChI | InChI=1S/C16H17NO4/c1-9(2)13(18)6-7-14(19)17-15(20)11-5-4-10(3)8-12(11)16(17)21/h4-5,8,14,19H,1,6-7H2,2-3H3 |
| InChIKey | HHONYUXWIGZCNN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|