C14H12ClNO4 — CID 139691608
5-chloro-2-(1-hydroxy-4-methyl-3-oxopent-4-enyl)isoindole-1,3-dione (PubChem CID 139691608) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is 5-chloro-2-(1-hydroxy-4-methyl-3-oxopent-4-enyl)isoindole-1,3-dione.
| Compound Name | 5-chloro-2-(1-hydroxy-4-methyl-3-oxopent-4-enyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139691608 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-chloro-2-(1-hydroxy-4-methyl-3-oxopent-4-enyl)isoindole-1,3-dione |
| SMILES | C=C(C)C(=O)CC(O)N1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C14H12ClNO4/c1-7(2)11(17)6-12(18)16-13(19)9-4-3-8(15)5-10(9)14(16)20/h3-5,12,18H,1,6H2,2H3 |
| InChIKey | DLUDVUXKBBMSQN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|