C17H25N3 — CID 139692559
1,3-dimethyl-N-(2-pyrrolidin-1-ylphenyl)piperidin-2-imine (PubChem CID 139692559) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1,3-dimethyl-N-(2-pyrrolidin-1-ylphenyl)piperidin-2-imine.
| Compound Name | 1,3-dimethyl-N-(2-pyrrolidin-1-ylphenyl)piperidin-2-imine |
|---|---|
| PubChem CID | 139692559 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1,3-dimethyl-N-(2-pyrrolidin-1-ylphenyl)piperidin-2-imine |
| SMILES | CC1CCCN(C)/C1=N/c1ccccc1N1CCCC1 |
| InChI | InChI=1S/C17H25N3/c1-14-8-7-11-19(2)17(14)18-15-9-3-4-10-16(15)20-12-5-6-13-20/h3-4,9-10,14H,5-8,11-13H2,1-2H3/b18-17+ |
| InChIKey | LBMKECKIWNOVFX-ISLYRVAYSA-N |
| XLogP | 3.68 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|