C18H27N3 — CID 15746300
1,3,3-trimethyl-N-(2-piperidin-1-ylphenyl)pyrrolidin-2-imine (PubChem CID 15746300) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 1,3,3-trimethyl-N-(2-piperidin-1-ylphenyl)pyrrolidin-2-imine.
| Compound Name | 1,3,3-trimethyl-N-(2-piperidin-1-ylphenyl)pyrrolidin-2-imine |
|---|---|
| PubChem CID | 15746300 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 1,3,3-trimethyl-N-(2-piperidin-1-ylphenyl)pyrrolidin-2-imine |
| SMILES | CN1CCC(C)(C)/C1=N/c1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C18H27N3/c1-18(2)11-14-20(3)17(18)19-15-9-5-6-10-16(15)21-12-7-4-8-13-21/h5-6,9-10H,4,7-8,11-14H2,1-3H3/b19-17- |
| InChIKey | UQKJRZKPDDVLSU-ZPHPHTNESA-N |
| XLogP | 4.07 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|