C13H19N3S — CID 15746491
methyl N'-(2-piperidin-1-ylphenyl)carbamimidothioate (PubChem CID 15746491) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is methyl N'-(2-piperidin-1-ylphenyl)carbamimidothioate.
| Compound Name | methyl N'-(2-piperidin-1-ylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 15746491 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | methyl N'-(2-piperidin-1-ylphenyl)carbamimidothioate |
| SMILES | CS/C(N)=N\c1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C13H19N3S/c1-17-13(14)15-11-7-3-4-8-12(11)16-9-5-2-6-10-16/h3-4,7-8H,2,5-6,9-10H2,1H3,(H2,14,15) |
| InChIKey | RTYADMQAWDBMNO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|