C8H13Br2N3O3 — CID 139694586
2,2-dibromo-N'-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide (PubChem CID 139694586) has the molecular formula C8H13Br2N3O3 and a molecular weight of 359.02 g/mol. Its IUPAC name is 2,2-dibromo-N'-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide.
| Compound Name | 2,2-dibromo-N'-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide |
|---|---|
| PubChem CID | 139694586 |
| Molecular Formula | C8H13Br2N3O3 |
| Molecular Weight | 359.02 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | 2,2-dibromo-N'-[(4-methyloxolan-3-yl)methyl]-2-nitroethanimidamide |
| SMILES | CC1COCC1C/N=C(\N)C(Br)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C8H13Br2N3O3/c1-5-3-16-4-6(5)2-12-7(11)8(9,10)13(14)15/h5-6H,2-4H2,1H3,(H2,11,12) |
| InChIKey | DJLZYLLREAGQRU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.02 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|