C15H32N4 — CID 139696874
3-[3-(dimethylamino)pentan-3-yliminomethylideneamino]-N,N-dimethylpentan-3-amine (PubChem CID 139696874) has the molecular formula C15H32N4 and a molecular weight of 268.45 g/mol. Its IUPAC name is 3-[3-(dimethylamino)pentan-3-yliminomethylideneamino]-N,N-dimethylpentan-3-amine.
| Compound Name | 3-[3-(dimethylamino)pentan-3-yliminomethylideneamino]-N,N-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 139696874 |
| Molecular Formula | C15H32N4 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 3-[3-(dimethylamino)pentan-3-yliminomethylideneamino]-N,N-dimethylpentan-3-amine |
| SMILES | CCC(CC)(N=C=NC(CC)(CC)N(C)C)N(C)C |
| InChI | InChI=1S/C15H32N4/c1-9-14(10-2,18(5)6)16-13-17-15(11-3,12-4)19(7)8/h9-12H2,1-8H3 |
| InChIKey | BGXJHZQIAQHMAG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|