C20H54N8P4 — CID 139922545
N-[dimethylamino-[1,2,2-tris[bis(dimethylamino)phosphanyl]butyl]phosphanyl]-N-methylmethanamine (PubChem CID 139922545) has the molecular formula C20H54N8P4 and a molecular weight of 530.60 g/mol. Its IUPAC name is N-[dimethylamino-[1,2,2-tris[bis(dimethylamino)phosphanyl]butyl]phosphanyl]-N-methylmethanamine.
| Compound Name | N-[dimethylamino-[1,2,2-tris[bis(dimethylamino)phosphanyl]butyl]phosphanyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 139922545 |
| Molecular Formula | C20H54N8P4 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | N-[dimethylamino-[1,2,2-tris[bis(dimethylamino)phosphanyl]butyl]phosphanyl]-N-methylmethanamine |
| SMILES | CCC(C(P(N(C)C)N(C)C)P(N(C)C)N(C)C)(P(N(C)C)N(C)C)P(N(C)C)N(C)C |
| InChI | InChI=1S/C20H54N8P4/c1-18-20(31(25(10)11)26(12)13,32(27(14)15)28(16)17)19(29(21(2)3)22(4)5)30(23(6)7)24(8)9/h19H,18H2,1-17H3 |
| InChIKey | XWQUIPOTWMXRQX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 25.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|