C13H18O5 — CID 139698192
1-O-methyl 5-O-(oxan-2-yl) (E)-2-methyl-4-methylidenepent-2-enedioate (PubChem CID 139698192) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 1-O-methyl 5-O-(oxan-2-yl) (E)-2-methyl-4-methylidenepent-2-enedioate.
| Compound Name | 1-O-methyl 5-O-(oxan-2-yl) (E)-2-methyl-4-methylidenepent-2-enedioate |
|---|---|
| PubChem CID | 139698192 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-O-methyl 5-O-(oxan-2-yl) (E)-2-methyl-4-methylidenepent-2-enedioate |
| SMILES | C=C(/C=C(\C)C(=O)OC)C(=O)OC1CCCCO1 |
| InChI | InChI=1S/C13H18O5/c1-9(12(14)16-3)8-10(2)13(15)18-11-6-4-5-7-17-11/h8,11H,2,4-7H2,1,3H3/b9-8+ |
| InChIKey | QANLRZVVHHOWAL-CMDGGOBGSA-N |
| XLogP | 1.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|