C21H16F2O5S — CID 139699331
methyl 3-(2,4-difluorophenoxy)-4-(4-methylsulfonylphenyl)benzoate (PubChem CID 139699331) has the molecular formula C21H16F2O5S and a molecular weight of 418.42 g/mol. Its IUPAC name is methyl 3-(2,4-difluorophenoxy)-4-(4-methylsulfonylphenyl)benzoate.
| Compound Name | methyl 3-(2,4-difluorophenoxy)-4-(4-methylsulfonylphenyl)benzoate |
|---|---|
| PubChem CID | 139699331 |
| Molecular Formula | C21H16F2O5S |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | methyl 3-(2,4-difluorophenoxy)-4-(4-methylsulfonylphenyl)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(S(C)(=O)=O)cc2)c(Oc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C21H16F2O5S/c1-27-21(24)14-5-9-17(13-3-7-16(8-4-13)29(2,25)26)20(11-14)28-19-10-6-15(22)12-18(19)23/h3-12H,1-2H3 |
| InChIKey | VKJAFLWTPFJWTB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |