C16H17NO3 — CID 139703123
(2S)-2-hydroxy-2-[2-(methoxymethyl)phenyl]-2-phenylacetamide (PubChem CID 139703123) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-[2-(methoxymethyl)phenyl]-2-phenylacetamide.
| Compound Name | (2S)-2-hydroxy-2-[2-(methoxymethyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 139703123 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2S)-2-hydroxy-2-[2-(methoxymethyl)phenyl]-2-phenylacetamide |
| SMILES | COCc1ccccc1[C@](O)(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO3/c1-20-11-12-7-5-6-10-14(12)16(19,15(17)18)13-8-3-2-4-9-13/h2-10,19H,11H2,1H3,(H2,17,18)/t16-/m0/s1 |
| InChIKey | PKSHUXINQCLUBO-INIZCTEOSA-N |
| XLogP | 1.55 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |