About 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate
4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate (PubChem CID 139703200) has the molecular formula C15H28O4Si
and a molecular weight of 300.47 g/mol. Its IUPAC name is 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate.
Molecular Properties
| Compound Name | 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate |
| PubChem CID | 139703200 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)O[Si](C)(C)C(C)C)C(=O)OCCCCC |
| InChI | InChI=1S/C15H28O4Si/c1-7-8-9-10-18-15(17)13(4)11-14(16)19-20(5,6)12(2)3/h12H,4,7-11H2,1-3,5-6H3 |
| InChIKey | KPSMGTZMNZQYLG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate?
The IUPAC name of 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate (CID 139703200) is 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate.
What is the SMILES notation for 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate?
The canonical SMILES for 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate is C=C(CC(=O)O[Si](C)(C)C(C)C)C(=O)OCCCCC.
What is the InChIKey of 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate?
The InChIKey is KPSMGTZMNZQYLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O4Si/c1-7-8-9-10-18-15(17)13(4)11-14(16)19-20(5,6)12(2)3/h12H,4,7-11H2,1-3,5-6H3.
What are the key properties of 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate?
4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate has a molecular weight of 300.47 g/mol, XLogP of 3.82, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[dimethyl(propan-2-yl)silyl] 1-O-pentyl 2-methylidenebutanedioate is sourced from PubChem (CID 139703200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).