C27H26FN3O9 — CID 139703987
3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]propyl N-(1,3-benzodioxol-5-yl)-N-ethylcarbamate (PubChem CID 139703987) has the molecular formula C27H26FN3O9 and a molecular weight of 555.52 g/mol. Its IUPAC name is 3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]propyl N-(1,3-benzodioxol-5-yl)-N-ethylcarbamate.
| Compound Name | 3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]propyl N-(1,3-benzodioxol-5-yl)-N-ethylcarbamate |
|---|---|
| PubChem CID | 139703987 |
| Molecular Formula | C27H26FN3O9 |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | 3-[7-(6-fluoro-1,2-benzoxazol-3-yl)-2,3-dioxo-1,4-dioxa-10-azaspiro[4.5]decan-10-yl]propyl N-(1,3-benzodioxol-5-yl)-N-ethylcarbamate |
| SMILES | CCN(C(=O)OCCCN1CCC(c2noc3cc(F)ccc23)CC12OC(=O)C(=O)O2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H26FN3O9/c1-2-31(18-5-7-20-22(13-18)37-15-36-20)26(34)35-11-3-9-30-10-8-16(14-27(30)38-24(32)25(33)39-27)23-19-6-4-17(28)12-21(19)40-29-23/h4-7,12-13,16H,2-3,8-11,14-15H2,1H3 |
| InChIKey | WTYFEECDIMPCTB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 129.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|