C15H13Cl3N2O4 — CID 139704320
2-[4-[2-[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]ethenyl]phenoxy]ethyl acetate (PubChem CID 139704320) has the molecular formula C15H13Cl3N2O4 and a molecular weight of 391.64 g/mol. Its IUPAC name is 2-[4-[2-[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]ethenyl]phenoxy]ethyl acetate.
| Compound Name | 2-[4-[2-[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]ethenyl]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 139704320 |
| Molecular Formula | C15H13Cl3N2O4 |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 2-[4-[2-[5-(trichloromethyl)-1,3,4-oxadiazol-2-yl]ethenyl]phenoxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc(C=Cc2nnc(C(Cl)(Cl)Cl)o2)cc1 |
| InChI | InChI=1S/C15H13Cl3N2O4/c1-10(21)22-8-9-23-12-5-2-11(3-6-12)4-7-13-19-20-14(24-13)15(16,17)18/h2-7H,8-9H2,1H3 |
| InChIKey | LFFGHZMCKOGDQT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|