C42H42N2O3 — CID 139704961
6'-[bis(2-methylpropyl)amino]-2'-(dibenzylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139704961) has the molecular formula C42H42N2O3 and a molecular weight of 622.81 g/mol. Its IUPAC name is 6'-[bis(2-methylpropyl)amino]-2'-(dibenzylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 6'-[bis(2-methylpropyl)amino]-2'-(dibenzylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139704961 |
| Molecular Formula | C42H42N2O3 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | 6'-[bis(2-methylpropyl)amino]-2'-(dibenzylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CC(C)CN(CC(C)C)c1ccc2c(c1)Oc1ccc(N(Cc3ccccc3)Cc3ccccc3)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C42H42N2O3/c1-29(2)25-43(26-30(3)4)34-19-21-37-40(24-34)46-39-22-20-33(23-38(39)42(37)36-18-12-11-17-35(36)41(45)47-42)44(27-31-13-7-5-8-14-31)28-32-15-9-6-10-16-32/h5-24,29-30H,25-28H2,1-4H3 |
| InChIKey | PDCWDCRKZUFAMF-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |