C12H23NO6S — CID 139705713
[(2S)-2-(2-ethoxyethoxy)-4-oxo-4-(prop-2-enylamino)butyl] methanesulfonate (PubChem CID 139705713) has the molecular formula C12H23NO6S and a molecular weight of 309.38 g/mol. Its IUPAC name is [(2S)-2-(2-ethoxyethoxy)-4-oxo-4-(prop-2-enylamino)butyl] methanesulfonate.
| Compound Name | [(2S)-2-(2-ethoxyethoxy)-4-oxo-4-(prop-2-enylamino)butyl] methanesulfonate |
|---|---|
| PubChem CID | 139705713 |
| Molecular Formula | C12H23NO6S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [(2S)-2-(2-ethoxyethoxy)-4-oxo-4-(prop-2-enylamino)butyl] methanesulfonate |
| SMILES | C=CCNC(=O)C[C@@H](COS(C)(=O)=O)OCCOCC |
| InChI | InChI=1S/C12H23NO6S/c1-4-6-13-12(14)9-11(10-19-20(3,15)16)18-8-7-17-5-2/h4,11H,1,5-10H2,2-3H3,(H,13,14)/t11-/m0/s1 |
| InChIKey | VOSKWZLSEDEUBT-NSHDSACASA-N |
| XLogP | 0.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|