C12H16N2O4 — CID 139705829
methyl 2-[2-[2-[2-(hydroxymethyl)phenyl]acetyl]hydrazinyl]acetate (PubChem CID 139705829) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-(hydroxymethyl)phenyl]acetyl]hydrazinyl]acetate.
| Compound Name | methyl 2-[2-[2-[2-(hydroxymethyl)phenyl]acetyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 139705829 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | methyl 2-[2-[2-[2-(hydroxymethyl)phenyl]acetyl]hydrazinyl]acetate |
| SMILES | COC(=O)CNNC(=O)Cc1ccccc1CO |
| InChI | InChI=1S/C12H16N2O4/c1-18-12(17)7-13-14-11(16)6-9-4-2-3-5-10(9)8-15/h2-5,13,15H,6-8H2,1H3,(H,14,16) |
| InChIKey | JBNUYTQEOKXWOD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|