C29H35N3O3 — CID 139707195
2-[3,4-bis(phenylmethoxy)phenyl]-N-(1,2-diethylpyrazolidin-4-yl)acetamide (PubChem CID 139707195) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is 2-[3,4-bis(phenylmethoxy)phenyl]-N-(1,2-diethylpyrazolidin-4-yl)acetamide.
| Compound Name | 2-[3,4-bis(phenylmethoxy)phenyl]-N-(1,2-diethylpyrazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 139707195 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 2-[3,4-bis(phenylmethoxy)phenyl]-N-(1,2-diethylpyrazolidin-4-yl)acetamide |
| SMILES | CCN1CC(NC(=O)Cc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)CN1CC |
| InChI | InChI=1S/C29H35N3O3/c1-3-31-19-26(20-32(31)4-2)30-29(33)18-25-15-16-27(34-21-23-11-7-5-8-12-23)28(17-25)35-22-24-13-9-6-10-14-24/h5-17,26H,3-4,18-22H2,1-2H3,(H,30,33) |
| InChIKey | JEXCCKULQIQAOG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |