3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid

C9H10N2O2S — CID 139708433

IUPAC3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)C1CSCN1c1cccnc1
InChIInChI=1S/C9H10N2O2S/c12-9(13)8-5-14-6-11(8)7-2-1-3-10-4-7/h1-4,8H,5-6H2,(H,12,13)
InChIKeyZLJCNILZLZMMQN-UHFFFAOYSA-N
MW210.26 g/mol
LogP1.05
Rot. Bonds2

About 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid

3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 139708433) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid
PubChem CID139708433
Molecular FormulaC9H10N2O2S
Molecular Weight210.26 g/mol
Exact Mass210.05
IUPAC Name3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid
SMILESO=C(O)C1CSCN1c1cccnc1
InChIInChI=1S/C9H10N2O2S/c12-9(13)8-5-14-6-11(8)7-2-1-3-10-4-7/h1-4,8H,5-6H2,(H,12,13)
InChIKeyZLJCNILZLZMMQN-UHFFFAOYSA-N
XLogP1.05
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.26
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid (CID 139708433) is 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid is O=C(O)C1CSCN1c1cccnc1.
What is the InChIKey of 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is ZLJCNILZLZMMQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c12-9(13)8-5-14-6-11(8)7-2-1-3-10-4-7/h1-4,8H,5-6H2,(H,12,13).
What are the key properties of 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid?
3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 210.26 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 139708433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).