C9H10N2O2S — CID 139708433
3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 139708433) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 139708433 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3-pyridin-3-yl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSCN1c1cccnc1 |
| InChI | InChI=1S/C9H10N2O2S/c12-9(13)8-5-14-6-11(8)7-2-1-3-10-4-7/h1-4,8H,5-6H2,(H,12,13) |
| InChIKey | ZLJCNILZLZMMQN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |