C18H25Cl2NO — CID 139709502
1-[2-[(3,4-dichlorophenyl)methoxy]ethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 139709502) has the molecular formula C18H25Cl2NO and a molecular weight of 342.31 g/mol. Its IUPAC name is 1-[2-[(3,4-dichlorophenyl)methoxy]ethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | 1-[2-[(3,4-dichlorophenyl)methoxy]ethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 139709502 |
| Molecular Formula | C18H25Cl2NO |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-[2-[(3,4-dichlorophenyl)methoxy]ethyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | Clc1ccc(COCCC2CCCN3CCCCC23)cc1Cl |
| InChI | InChI=1S/C18H25Cl2NO/c19-16-7-6-14(12-17(16)20)13-22-11-8-15-4-3-10-21-9-2-1-5-18(15)21/h6-7,12,15,18H,1-5,8-11,13H2 |
| InChIKey | LABZMNNSPZQKIH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|