C15H20Cl2N2 — CID 22878400
(8aR)-1-[2-(3,4-dichlorophenyl)ethyl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine (PubChem CID 22878400) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.24 g/mol. Its IUPAC name is (8aR)-1-[2-(3,4-dichlorophenyl)ethyl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine.
| Compound Name | (8aR)-1-[2-(3,4-dichlorophenyl)ethyl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 22878400 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (8aR)-1-[2-(3,4-dichlorophenyl)ethyl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,2-a]pyridine |
| SMILES | Clc1ccc(CCN2CCN3CCCC[C@H]32)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2/c16-13-5-4-12(11-14(13)17)6-8-19-10-9-18-7-2-1-3-15(18)19/h4-5,11,15H,1-3,6-10H2/t15-/m1/s1 |
| InChIKey | XLQFAWRWSVNDFI-OAHLLOKOSA-N |
| XLogP | 3.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |