C34H40N4O2 — CID 139710168
1-[4-[bis[4-(dimethylamino)phenyl]methylidene]piperidin-1-yl]-3-quinolin-5-yloxypropan-2-ol (PubChem CID 139710168) has the molecular formula C34H40N4O2 and a molecular weight of 536.72 g/mol. Its IUPAC name is 1-[4-[bis[4-(dimethylamino)phenyl]methylidene]piperidin-1-yl]-3-quinolin-5-yloxypropan-2-ol.
| Compound Name | 1-[4-[bis[4-(dimethylamino)phenyl]methylidene]piperidin-1-yl]-3-quinolin-5-yloxypropan-2-ol |
|---|---|
| PubChem CID | 139710168 |
| Molecular Formula | C34H40N4O2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 1-[4-[bis[4-(dimethylamino)phenyl]methylidene]piperidin-1-yl]-3-quinolin-5-yloxypropan-2-ol |
| SMILES | CN(C)c1ccc(C(=C2CCN(CC(O)COc3cccc4ncccc34)CC2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H40N4O2/c1-36(2)28-14-10-25(11-15-28)34(26-12-16-29(17-13-26)37(3)4)27-18-21-38(22-19-27)23-30(39)24-40-33-9-5-8-32-31(33)7-6-20-35-32/h5-17,20,30,39H,18-19,21-24H2,1-4H3 |
| InChIKey | ROXLMSUABACZDO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|