C30H31N3O3 — CID 90259492
2-[4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-2,2-diphenylacetaldehyde (PubChem CID 90259492) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-[4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-2,2-diphenylacetaldehyde.
| Compound Name | 2-[4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-2,2-diphenylacetaldehyde |
|---|---|
| PubChem CID | 90259492 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 2-[4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-2,2-diphenylacetaldehyde |
| SMILES | O=CC(c1ccccc1)(c1ccccc1)N1CCN(CC(O)COc2cccc3ncccc23)CC1 |
| InChI | InChI=1S/C30H31N3O3/c34-23-30(24-9-3-1-4-10-24,25-11-5-2-6-12-25)33-19-17-32(18-20-33)21-26(35)22-36-29-15-7-14-28-27(29)13-8-16-31-28/h1-16,23,26,35H,17-22H2 |
| InChIKey | WCGHVAJPMXNOLX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|