C48H58N4O4 — CID 59912221
N-(1,7-diphenylheptan-4-yl)-4-[(2R)-2-hydroxy-3-quinolin-5-yloxypropyl]-1-(6-phenylhexanoyl)piperazine-2-carboxamide (PubChem CID 59912221) has the molecular formula C48H58N4O4 and a molecular weight of 755.02 g/mol. Its IUPAC name is N-(1,7-diphenylheptan-4-yl)-4-[(2R)-2-hydroxy-3-quinolin-5-yloxypropyl]-1-(6-phenylhexanoyl)piperazine-2-carboxamide.
| Compound Name | N-(1,7-diphenylheptan-4-yl)-4-[(2R)-2-hydroxy-3-quinolin-5-yloxypropyl]-1-(6-phenylhexanoyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 59912221 |
| Molecular Formula | C48H58N4O4 |
| Molecular Weight | 755.02 g/mol |
| Exact Mass | 754.45 |
| IUPAC Name | N-(1,7-diphenylheptan-4-yl)-4-[(2R)-2-hydroxy-3-quinolin-5-yloxypropyl]-1-(6-phenylhexanoyl)piperazine-2-carboxamide |
| SMILES | O=C(NC(CCCc1ccccc1)CCCc1ccccc1)C1CN(C[C@@H](O)COc2cccc3ncccc23)CCN1C(=O)CCCCCc1ccccc1 |
| InChI | InChI=1S/C48H58N4O4/c53-42(37-56-46-30-15-29-44-43(46)28-16-32-49-44)35-51-33-34-52(47(54)31-12-4-11-19-38-17-5-1-6-18-38)45(36-51)48(55)50-41(26-13-24-39-20-7-2-8-21-39)27-14-25-40-22-9-3-10-23-40/h1-3,5-10,15-18,20-23,28-30,32,41-42,45,53H,4,11-14,19,24-27,31,33-37H2,(H,50,55)/t42-,45?/m1/s1 |
| InChIKey | MUKFPBVTMLJCLS-UUNDMPNCSA-N |
| XLogP | 7.82 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.02 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|