C38H46N4O4 — CID 20622404
N-(1,7-diphenylheptan-4-yl)-3-[4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-3-oxopropanamide (PubChem CID 20622404) has the molecular formula C38H46N4O4 and a molecular weight of 622.81 g/mol. Its IUPAC name is N-(1,7-diphenylheptan-4-yl)-3-[4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-3-oxopropanamide.
| Compound Name | N-(1,7-diphenylheptan-4-yl)-3-[4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-3-oxopropanamide |
|---|---|
| PubChem CID | 20622404 |
| Molecular Formula | C38H46N4O4 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | N-(1,7-diphenylheptan-4-yl)-3-[4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-3-oxopropanamide |
| SMILES | O=C(CC(=O)N1CCN(CC(O)COc2cccc3ncccc23)CC1)NC(CCCc1ccccc1)CCCc1ccccc1 |
| InChI | InChI=1S/C38H46N4O4/c43-33(29-46-36-21-9-20-35-34(36)19-10-22-39-35)28-41-23-25-42(26-24-41)38(45)27-37(44)40-32(17-7-15-30-11-3-1-4-12-30)18-8-16-31-13-5-2-6-14-31/h1-6,9-14,19-22,32-33,43H,7-8,15-18,23-29H2,(H,40,44) |
| InChIKey | LCPLGNLDEOTYOQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|