C30H29N3O4 — CID 10791379
[4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-(9H-xanthen-9-yl)methanone (PubChem CID 10791379) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is [4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-(9H-xanthen-9-yl)methanone.
| Compound Name | [4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-(9H-xanthen-9-yl)methanone |
|---|---|
| PubChem CID | 10791379 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | [4-(2-hydroxy-3-quinolin-5-yloxypropyl)piperazin-1-yl]-(9H-xanthen-9-yl)methanone |
| SMILES | O=C(C1c2ccccc2Oc2ccccc21)N1CCN(CC(O)COc2cccc3ncccc23)CC1 |
| InChI | InChI=1S/C30H29N3O4/c34-21(20-36-26-13-5-10-25-22(26)9-6-14-31-25)19-32-15-17-33(18-16-32)30(35)29-23-7-1-3-11-27(23)37-28-12-4-2-8-24(28)29/h1-14,21,29,34H,15-20H2 |
| InChIKey | FWJPNVOQWGVWFU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |