C31H31F7O — CID 139711170
1,2,4,5-tetrafluoro-3-(4-phenylphenyl)-6-[1-[2-propyl-1-(trifluoromethoxy)cyclohexyl]propyl]benzene (PubChem CID 139711170) has the molecular formula C31H31F7O and a molecular weight of 552.57 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-(4-phenylphenyl)-6-[1-[2-propyl-1-(trifluoromethoxy)cyclohexyl]propyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-(4-phenylphenyl)-6-[1-[2-propyl-1-(trifluoromethoxy)cyclohexyl]propyl]benzene |
|---|---|
| PubChem CID | 139711170 |
| Molecular Formula | C31H31F7O |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-(4-phenylphenyl)-6-[1-[2-propyl-1-(trifluoromethoxy)cyclohexyl]propyl]benzene |
| SMILES | CCCC1CCCCC1(OC(F)(F)F)C(CC)c1c(F)c(F)c(-c2ccc(-c3ccccc3)cc2)c(F)c1F |
| InChI | InChI=1S/C31H31F7O/c1-3-10-22-13-8-9-18-30(22,39-31(36,37)38)23(4-2)25-28(34)26(32)24(27(33)29(25)35)21-16-14-20(15-17-21)19-11-6-5-7-12-19/h5-7,11-12,14-17,22-23H,3-4,8-10,13,18H2,1-2H3 |
| InChIKey | SNYCWKNIJCFSEM-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|