C32H32F8 — CID 139711119
1-[1-[2-butyl-1-(trifluoromethyl)cyclohexyl]propyl]-2,3,5,6-tetrafluoro-4-(2-fluoro-4-phenylphenyl)benzene (PubChem CID 139711119) has the molecular formula C32H32F8 and a molecular weight of 568.59 g/mol. Its IUPAC name is 1-[1-[2-butyl-1-(trifluoromethyl)cyclohexyl]propyl]-2,3,5,6-tetrafluoro-4-(2-fluoro-4-phenylphenyl)benzene.
| Compound Name | 1-[1-[2-butyl-1-(trifluoromethyl)cyclohexyl]propyl]-2,3,5,6-tetrafluoro-4-(2-fluoro-4-phenylphenyl)benzene |
|---|---|
| PubChem CID | 139711119 |
| Molecular Formula | C32H32F8 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 1-[1-[2-butyl-1-(trifluoromethyl)cyclohexyl]propyl]-2,3,5,6-tetrafluoro-4-(2-fluoro-4-phenylphenyl)benzene |
| SMILES | CCCCC1CCCCC1(C(CC)c1c(F)c(F)c(-c2ccc(-c3ccccc3)cc2F)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C32H32F8/c1-3-5-13-21-14-9-10-17-31(21,32(38,39)40)23(4-2)26-29(36)27(34)25(28(35)30(26)37)22-16-15-20(18-24(22)33)19-11-7-6-8-12-19/h6-8,11-12,15-16,18,21,23H,3-5,9-10,13-14,17H2,1-2H3 |
| InChIKey | GGPXYXSPFUXWAL-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|