C33H38F4O — CID 139711141
1,2,4,5-tetrafluoro-3-[1-(1-methoxy-2-pentylcyclohexyl)propyl]-6-(4-phenylphenyl)benzene (PubChem CID 139711141) has the molecular formula C33H38F4O and a molecular weight of 526.66 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[1-(1-methoxy-2-pentylcyclohexyl)propyl]-6-(4-phenylphenyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[1-(1-methoxy-2-pentylcyclohexyl)propyl]-6-(4-phenylphenyl)benzene |
|---|---|
| PubChem CID | 139711141 |
| Molecular Formula | C33H38F4O |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[1-(1-methoxy-2-pentylcyclohexyl)propyl]-6-(4-phenylphenyl)benzene |
| SMILES | CCCCCC1CCCCC1(OC)C(CC)c1c(F)c(F)c(-c2ccc(-c3ccccc3)cc2)c(F)c1F |
| InChI | InChI=1S/C33H38F4O/c1-4-6-8-15-25-16-11-12-21-33(25,38-3)26(5-2)28-31(36)29(34)27(30(35)32(28)37)24-19-17-23(18-20-24)22-13-9-7-10-14-22/h7,9-10,13-14,17-20,25-26H,4-6,8,11-12,15-16,21H2,1-3H3 |
| InChIKey | KBTZZHXKEUKNIW-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|