C32H36FN3O5 — CID 139713490
propan-2-yl 4-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propoxymethoxymethyl]-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 139713490) has the molecular formula C32H36FN3O5 and a molecular weight of 561.65 g/mol. Its IUPAC name is propan-2-yl 4-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propoxymethoxymethyl]-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | propan-2-yl 4-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propoxymethoxymethyl]-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 139713490 |
| Molecular Formula | C32H36FN3O5 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | propan-2-yl 4-[3-[4-(4-fluorobenzoyl)piperidin-1-yl]propoxymethoxymethyl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CC(C)OC(=O)c1ncc2[nH]c3ccccc3c2c1COCOCCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C32H36FN3O5/c1-21(2)41-32(38)30-26(29-25-6-3-4-7-27(25)35-28(29)18-34-30)19-40-20-39-17-5-14-36-15-12-23(13-16-36)31(37)22-8-10-24(33)11-9-22/h3-4,6-11,18,21,23,35H,5,12-17,19-20H2,1-2H3 |
| InChIKey | IXPLALQXZGSOII-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|