C31H27N3O8S — CID 139716055
2-[2-(carboxymethoxy)-4-[2-[[2-(3,3-diphenylprop-2-enoylamino)-1,3-thiazole-4-carbonyl]amino]ethyl]phenoxy]acetic acid (PubChem CID 139716055) has the molecular formula C31H27N3O8S and a molecular weight of 601.64 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)-4-[2-[[2-(3,3-diphenylprop-2-enoylamino)-1,3-thiazole-4-carbonyl]amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-(carboxymethoxy)-4-[2-[[2-(3,3-diphenylprop-2-enoylamino)-1,3-thiazole-4-carbonyl]amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 139716055 |
| Molecular Formula | C31H27N3O8S |
| Molecular Weight | 601.64 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | 2-[2-(carboxymethoxy)-4-[2-[[2-(3,3-diphenylprop-2-enoylamino)-1,3-thiazole-4-carbonyl]amino]ethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CCNC(=O)c2csc(NC(=O)C=C(c3ccccc3)c3ccccc3)n2)cc1OCC(=O)O |
| InChI | InChI=1S/C31H27N3O8S/c35-27(16-23(21-7-3-1-4-8-21)22-9-5-2-6-10-22)34-31-33-24(19-43-31)30(40)32-14-13-20-11-12-25(41-17-28(36)37)26(15-20)42-18-29(38)39/h1-12,15-16,19H,13-14,17-18H2,(H,32,40)(H,36,37)(H,38,39)(H,33,34,35) |
| InChIKey | LOTKIYYDHHCTIC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 164.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|