C35H38ClN2O6P — CID 139716136
[(3S,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl-N,N-diphenylphosphonamidic acid (PubChem CID 139716136) has the molecular formula C35H38ClN2O6P and a molecular weight of 649.12 g/mol. Its IUPAC name is [(3S,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl-N,N-diphenylphosphonamidic acid.
| Compound Name | [(3S,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl-N,N-diphenylphosphonamidic acid |
|---|---|
| PubChem CID | 139716136 |
| Molecular Formula | C35H38ClN2O6P |
| Molecular Weight | 649.12 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | [(3S,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl-N,N-diphenylphosphonamidic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CP(=O)(O)N(c3ccccc3)c3ccccc3)C(=O)N(CC(C)(C)C)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C35H38ClN2O6P/c1-35(2,3)23-37-29-20-19-24(36)21-28(29)32(27-17-12-18-30(42-4)33(27)43-5)44-31(34(37)39)22-45(40,41)38(25-13-8-6-9-14-25)26-15-10-7-11-16-26/h6-21,31-32H,22-23H2,1-5H3,(H,40,41)/t31-,32-/m1/s1 |
| InChIKey | LKWISHBAAHQQER-ROJLCIKYSA-N |
| XLogP | 8.25 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.12 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|