C20H17ClN2O3S — CID 139716660
methyl 4-[[1-(4-chlorophenyl)ethylideneamino]oxymethyl]-2-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 139716660) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is methyl 4-[[1-(4-chlorophenyl)ethylideneamino]oxymethyl]-2-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-[[1-(4-chlorophenyl)ethylideneamino]oxymethyl]-2-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 139716660 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | methyl 4-[[1-(4-chlorophenyl)ethylideneamino]oxymethyl]-2-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(-c2ccccc2)nc1CON=C(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN2O3S/c1-13(14-8-10-16(21)11-9-14)23-26-12-17-18(20(24)25-2)27-19(22-17)15-6-4-3-5-7-15/h3-11H,12H2,1-2H3 |
| InChIKey | JOSXCLBIFWNEFT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|