C17H15N5O3S3 — CID 139718671
(6R,7R)-7-amino-3-[4-[1-(2-amino-2-oxoethyl)pyridin-1-ium-4-yl]-1,3-thiazol-2-yl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate (PubChem CID 139718671) has the molecular formula C17H15N5O3S3 and a molecular weight of 433.54 g/mol. Its IUPAC name is (6R,7R)-7-amino-3-[4-[1-(2-amino-2-oxoethyl)pyridin-1-ium-4-yl]-1,3-thiazol-2-yl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate.
| Compound Name | (6R,7R)-7-amino-3-[4-[1-(2-amino-2-oxoethyl)pyridin-1-ium-4-yl]-1,3-thiazol-2-yl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 139718671 |
| Molecular Formula | C17H15N5O3S3 |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | (6R,7R)-7-amino-3-[4-[1-(2-amino-2-oxoethyl)pyridin-1-ium-4-yl]-1,3-thiazol-2-yl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
| SMILES | NC(=O)C[n+]1ccc(-c2csc(C3=C(C(=O)[S-])N4C(=O)[C@@H](N)[C@H]4SC3)n2)cc1 |
| InChI | InChI=1S/C17H15N5O3S3/c18-11(23)5-21-3-1-8(2-4-21)10-7-27-14(20-10)9-6-28-16-12(19)15(24)22(16)13(9)17(25)26/h1-4,7,12,16H,5-6,19H2,(H2-,18,23,25,26)/t12-,16-/m1/s1 |
| InChIKey | MIWQBXSBBXMUDH-MLGOLLRUSA-N |
| XLogP | -0.39 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|